{4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}(pentafluorophenyl)methanone
Chemical Structure Depiction of
{4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}(pentafluorophenyl)methanone
{4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}(pentafluorophenyl)methanone
Compound characteristics
| Compound ID: | V008-9362 |
| Compound Name: | {4-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}(pentafluorophenyl)methanone |
| Molecular Weight: | 457.79 |
| Molecular Formula: | C20 H13 Cl F5 N3 O2 |
| Smiles: | C1CN(CCC1c1nc(c2ccccc2[Cl])no1)C(c1c(c(c(c(c1F)F)F)F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3952 |
| logD: | 5.3952 |
| logSw: | -6.0366 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.292 |
| InChI Key: | LKZBJKILDAKCRO-UHFFFAOYSA-N |