2-ethyl-N-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]hexanamide
Chemical Structure Depiction of
2-ethyl-N-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]hexanamide
2-ethyl-N-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]hexanamide
Compound characteristics
| Compound ID: | V008-9689 |
| Compound Name: | 2-ethyl-N-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]hexanamide |
| Molecular Weight: | 363.5 |
| Molecular Formula: | C23 H29 N3 O |
| Salt: | not_available |
| Smiles: | CCCCC(CC)C(Nc1c(c2ccc(C)cc2)nc2ccc(C)cn12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.033 |
| logD: | 6.0323 |
| logSw: | -5.3504 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.022 |
| InChI Key: | HHMRPGYOOYVKDQ-SFHVURJKSA-N |