2-[(3,4-dichlorophenyl)methyl]-4-({[(4-fluorophenyl)methyl]sulfanyl}methyl)-1,3-thiazole
Chemical Structure Depiction of
2-[(3,4-dichlorophenyl)methyl]-4-({[(4-fluorophenyl)methyl]sulfanyl}methyl)-1,3-thiazole
2-[(3,4-dichlorophenyl)methyl]-4-({[(4-fluorophenyl)methyl]sulfanyl}methyl)-1,3-thiazole
Compound characteristics
| Compound ID: | V009-0237 |
| Compound Name: | 2-[(3,4-dichlorophenyl)methyl]-4-({[(4-fluorophenyl)methyl]sulfanyl}methyl)-1,3-thiazole |
| Molecular Weight: | 398.35 |
| Molecular Formula: | C18 H14 Cl2 F N S2 |
| Salt: | not_available |
| Smiles: | C(c1ccc(c(c1)[Cl])[Cl])c1nc(CSCc2ccc(cc2)F)cs1 |
| Stereo: | ACHIRAL |
| logP: | 6.7954 |
| logD: | 6.7954 |
| logSw: | -6.9452 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 10.6913 |
| InChI Key: | NUWNRYNCAKVSBC-UHFFFAOYSA-N |