1-{[(2H-1,3-benzodioxol-5-yl)methyl][(2,3-dimethoxyphenyl)methyl]amino}-3-[(prop-2-en-1-yl)oxy]propan-2-ol
Chemical Structure Depiction of
1-{[(2H-1,3-benzodioxol-5-yl)methyl][(2,3-dimethoxyphenyl)methyl]amino}-3-[(prop-2-en-1-yl)oxy]propan-2-ol
1-{[(2H-1,3-benzodioxol-5-yl)methyl][(2,3-dimethoxyphenyl)methyl]amino}-3-[(prop-2-en-1-yl)oxy]propan-2-ol
Compound characteristics
| Compound ID: | V009-0692 |
| Compound Name: | 1-{[(2H-1,3-benzodioxol-5-yl)methyl][(2,3-dimethoxyphenyl)methyl]amino}-3-[(prop-2-en-1-yl)oxy]propan-2-ol |
| Molecular Weight: | 415.49 |
| Molecular Formula: | C23 H29 N O6 |
| Salt: | not_available |
| Smiles: | COc1cccc(CN(CC(COCC=C)O)Cc2ccc3c(c2)OCO3)c1OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2041 |
| logD: | 1.3156 |
| logSw: | -3.1078 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.386 |
| InChI Key: | BZASROFTTWZDOL-IBGZPJMESA-N |