N-[(4-fluorophenyl)methyl]-N-[(furan-2-yl)methyl]-N~2~-(methoxyacetyl)-N~2~-(prop-2-en-1-yl)glycinamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-N-[(furan-2-yl)methyl]-N~2~-(methoxyacetyl)-N~2~-(prop-2-en-1-yl)glycinamide
N-[(4-fluorophenyl)methyl]-N-[(furan-2-yl)methyl]-N~2~-(methoxyacetyl)-N~2~-(prop-2-en-1-yl)glycinamide
Compound characteristics
| Compound ID: | V009-1287 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-N-[(furan-2-yl)methyl]-N~2~-(methoxyacetyl)-N~2~-(prop-2-en-1-yl)glycinamide |
| Molecular Weight: | 374.41 |
| Molecular Formula: | C20 H23 F N2 O4 |
| Smiles: | COCC(N(CC=C)CC(N(Cc1ccc(cc1)F)Cc1ccco1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.6854 |
| logD: | 1.6854 |
| logSw: | -1.8403 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.028 |
| InChI Key: | FVFJSKPUNMTRKP-UHFFFAOYSA-N |