[5-({[(2,3-dimethoxyphenyl)methyl](propan-2-yl)amino}methyl)furan-2-yl]di(thiophen-2-yl)methanol
Chemical Structure Depiction of
[5-({[(2,3-dimethoxyphenyl)methyl](propan-2-yl)amino}methyl)furan-2-yl]di(thiophen-2-yl)methanol
[5-({[(2,3-dimethoxyphenyl)methyl](propan-2-yl)amino}methyl)furan-2-yl]di(thiophen-2-yl)methanol
Compound characteristics
| Compound ID: | V009-1415 |
| Compound Name: | [5-({[(2,3-dimethoxyphenyl)methyl](propan-2-yl)amino}methyl)furan-2-yl]di(thiophen-2-yl)methanol |
| Molecular Weight: | 483.65 |
| Molecular Formula: | C26 H29 N O4 S2 |
| Salt: | not_available |
| Smiles: | CC(C)N(Cc1cccc(c1OC)OC)Cc1ccc(C(c2cccs2)(c2cccs2)O)o1 |
| Stereo: | ACHIRAL |
| logP: | 6.1295 |
| logD: | 3.4425 |
| logSw: | -5.6924 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.336 |
| InChI Key: | FEEGVQBPUHRYSX-UHFFFAOYSA-N |