6-bromo-2-phenyl-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine
Chemical Structure Depiction of
6-bromo-2-phenyl-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine
6-bromo-2-phenyl-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine
Compound characteristics
| Compound ID: | V009-2573 |
| Compound Name: | 6-bromo-2-phenyl-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine |
| Molecular Weight: | 400.36 |
| Molecular Formula: | C21 H26 Br N3 |
| Salt: | not_available |
| Smiles: | CC(C)(C)CC(C)(C)Nc1c(c2ccccc2)nc2ccc(cn12)[Br] |
| Stereo: | ACHIRAL |
| logP: | 6.446 |
| logD: | 6.404 |
| logSw: | -5.9488 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 18.4567 |
| InChI Key: | HJNGXSSVOLCZPR-UHFFFAOYSA-N |