N-cyclopropyl-4-methoxy-N-[(2-{[2-(propan-2-yl)phenoxy]methyl}-1,3-thiazol-4-yl)methyl]benzamide
Chemical Structure Depiction of
N-cyclopropyl-4-methoxy-N-[(2-{[2-(propan-2-yl)phenoxy]methyl}-1,3-thiazol-4-yl)methyl]benzamide
N-cyclopropyl-4-methoxy-N-[(2-{[2-(propan-2-yl)phenoxy]methyl}-1,3-thiazol-4-yl)methyl]benzamide
Compound characteristics
| Compound ID: | V009-2730 |
| Compound Name: | N-cyclopropyl-4-methoxy-N-[(2-{[2-(propan-2-yl)phenoxy]methyl}-1,3-thiazol-4-yl)methyl]benzamide |
| Molecular Weight: | 436.57 |
| Molecular Formula: | C25 H28 N2 O3 S |
| Smiles: | CC(C)c1ccccc1OCc1nc(CN(C2CC2)C(c2ccc(cc2)OC)=O)cs1 |
| Stereo: | ACHIRAL |
| logP: | 5.9135 |
| logD: | 5.9135 |
| logSw: | -5.6309 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 41.608 |
| InChI Key: | JFLVBRAIMRKSEA-UHFFFAOYSA-N |