N'-tert-butyl-N-({2-[(2,3-dimethylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-[2-(morpholin-4-yl)ethyl]urea
Chemical Structure Depiction of
N'-tert-butyl-N-({2-[(2,3-dimethylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-[2-(morpholin-4-yl)ethyl]urea
N'-tert-butyl-N-({2-[(2,3-dimethylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-[2-(morpholin-4-yl)ethyl]urea
Compound characteristics
| Compound ID: | V009-4256 |
| Compound Name: | N'-tert-butyl-N-({2-[(2,3-dimethylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-[2-(morpholin-4-yl)ethyl]urea |
| Molecular Weight: | 460.64 |
| Molecular Formula: | C24 H36 N4 O3 S |
| Salt: | not_available |
| Smiles: | Cc1cccc(c1C)OCc1nc(CN(CCN2CCOCC2)C(NC(C)(C)C)=O)cs1 |
| Stereo: | ACHIRAL |
| logP: | 4.1823 |
| logD: | 3.3317 |
| logSw: | -4.0856 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.596 |
| InChI Key: | JOSKRRQOQWYJIY-UHFFFAOYSA-N |