1-({[3-(3,4-dichlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}[(4-fluorophenyl)methyl]amino)-3-phenylpropan-2-ol
Chemical Structure Depiction of
1-({[3-(3,4-dichlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}[(4-fluorophenyl)methyl]amino)-3-phenylpropan-2-ol
1-({[3-(3,4-dichlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}[(4-fluorophenyl)methyl]amino)-3-phenylpropan-2-ol
Compound characteristics
| Compound ID: | V009-8707 |
| Compound Name: | 1-({[3-(3,4-dichlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}[(4-fluorophenyl)methyl]amino)-3-phenylpropan-2-ol |
| Molecular Weight: | 487.4 |
| Molecular Formula: | C26 H25 Cl2 F N2 O2 |
| Smiles: | C1C(CN(CC(Cc2ccccc2)O)Cc2ccc(cc2)F)ON=C1c1ccc(c(c1)[Cl])[Cl] |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 6.3323 |
| logD: | 6.3233 |
| logSw: | -6.2528 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.134 |
| InChI Key: | VLFVYSKZIPNLLA-UHFFFAOYSA-N |