1-[(4-fluorophenyl)methyl]-3'-(3-methoxybenzoyl)-5',5'-dimethylspiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one
Chemical Structure Depiction of
1-[(4-fluorophenyl)methyl]-3'-(3-methoxybenzoyl)-5',5'-dimethylspiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one
1-[(4-fluorophenyl)methyl]-3'-(3-methoxybenzoyl)-5',5'-dimethylspiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one
Compound characteristics
| Compound ID: | V009-8943 |
| Compound Name: | 1-[(4-fluorophenyl)methyl]-3'-(3-methoxybenzoyl)-5',5'-dimethylspiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one |
| Molecular Weight: | 476.57 |
| Molecular Formula: | C27 H25 F N2 O3 S |
| Smiles: | CC1(C)CN(C(c2cccc(c2)OC)=O)C2(C(N(Cc3ccc(cc3)F)c3ccccc23)=O)S1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5527 |
| logD: | 5.5527 |
| logSw: | -5.4902 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 39.057 |
| InChI Key: | WXUXKIZHBZRCFV-MHZLTWQESA-N |