3-chloro-N-(3-fluorophenyl)-1-benzothiophene-2-carboxamide
Chemical Structure Depiction of
3-chloro-N-(3-fluorophenyl)-1-benzothiophene-2-carboxamide
3-chloro-N-(3-fluorophenyl)-1-benzothiophene-2-carboxamide
Compound characteristics
| Compound ID: | V010-1074 |
| Compound Name: | 3-chloro-N-(3-fluorophenyl)-1-benzothiophene-2-carboxamide |
| Molecular Weight: | 305.76 |
| Molecular Formula: | C15 H9 Cl F N O S |
| Smiles: | c1ccc2c(c1)c(c(C(Nc1cccc(c1)F)=O)s2)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.825 |
| logD: | 4.8164 |
| logSw: | -5.0886 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.0764 |
| InChI Key: | HKIAGIHDGMUFEN-UHFFFAOYSA-N |