N-(2-{benzyl[(3-methylthiophen-2-yl)methyl]amino}-2-oxoethyl)-N-cyclohexyl-3-methoxybenzamide
Chemical Structure Depiction of
N-(2-{benzyl[(3-methylthiophen-2-yl)methyl]amino}-2-oxoethyl)-N-cyclohexyl-3-methoxybenzamide
N-(2-{benzyl[(3-methylthiophen-2-yl)methyl]amino}-2-oxoethyl)-N-cyclohexyl-3-methoxybenzamide
Compound characteristics
| Compound ID: | V010-1671 |
| Compound Name: | N-(2-{benzyl[(3-methylthiophen-2-yl)methyl]amino}-2-oxoethyl)-N-cyclohexyl-3-methoxybenzamide |
| Molecular Weight: | 490.66 |
| Molecular Formula: | C29 H34 N2 O3 S |
| Smiles: | Cc1ccsc1CN(Cc1ccccc1)C(CN(C1CCCCC1)C(c1cccc(c1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8106 |
| logD: | 5.8106 |
| logSw: | -5.3946 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.668 |
| InChI Key: | ASGRTSRPTOKGMQ-UHFFFAOYSA-N |