ethyl 5-phenyl-2-[2-(trifluoromethyl)benzamido]thiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 5-phenyl-2-[2-(trifluoromethyl)benzamido]thiophene-3-carboxylate
ethyl 5-phenyl-2-[2-(trifluoromethyl)benzamido]thiophene-3-carboxylate
Compound characteristics
| Compound ID: | V010-1898 |
| Compound Name: | ethyl 5-phenyl-2-[2-(trifluoromethyl)benzamido]thiophene-3-carboxylate |
| Molecular Weight: | 419.42 |
| Molecular Formula: | C21 H16 F3 N O3 S |
| Smiles: | CCOC(c1cc(c2ccccc2)sc1NC(c1ccccc1C(F)(F)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4084 |
| logD: | 2.2662 |
| logSw: | -5.4302 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.606 |
| InChI Key: | ATJHIUQSQDPYJQ-UHFFFAOYSA-N |