2-[(3,5-dimethylphenoxy)methyl]-N-(2-heptanamidoethyl)-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
2-[(3,5-dimethylphenoxy)methyl]-N-(2-heptanamidoethyl)-1,3-thiazole-4-carboxamide
2-[(3,5-dimethylphenoxy)methyl]-N-(2-heptanamidoethyl)-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | V010-2213 |
| Compound Name: | 2-[(3,5-dimethylphenoxy)methyl]-N-(2-heptanamidoethyl)-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 417.57 |
| Molecular Formula: | C22 H31 N3 O3 S |
| Smiles: | CCCCCCC(NCCNC(c1csc(COc2cc(C)cc(C)c2)n1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1689 |
| logD: | 4.1689 |
| logSw: | -3.9819 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.806 |
| InChI Key: | LEAQNFOAGMFZTL-UHFFFAOYSA-N |