2-phenyl-1-(2-{5-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl}pyrrolidin-1-yl)ethan-1-one
Chemical Structure Depiction of
2-phenyl-1-(2-{5-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl}pyrrolidin-1-yl)ethan-1-one
2-phenyl-1-(2-{5-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl}pyrrolidin-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | V010-2489 |
| Compound Name: | 2-phenyl-1-(2-{5-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl}pyrrolidin-1-yl)ethan-1-one |
| Molecular Weight: | 450.46 |
| Molecular Formula: | C26 H21 F3 N2 O2 |
| Smiles: | C1CC(c2nc3cc(ccc3o2)c2ccc(cc2)C(F)(F)F)N(C1)C(Cc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.2139 |
| logD: | 6.2139 |
| logSw: | -6.1468 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.958 |
| InChI Key: | HPSLAOXTTAJGFG-QFIPXVFZSA-N |