2-(4-{2-methoxy-5-[methyl(2-phenylethyl)sulfamoyl]phenyl}piperazin-1-yl)-2-oxo-1-phenylethyl acetate
Chemical Structure Depiction of
2-(4-{2-methoxy-5-[methyl(2-phenylethyl)sulfamoyl]phenyl}piperazin-1-yl)-2-oxo-1-phenylethyl acetate
2-(4-{2-methoxy-5-[methyl(2-phenylethyl)sulfamoyl]phenyl}piperazin-1-yl)-2-oxo-1-phenylethyl acetate
Compound characteristics
| Compound ID: | V010-3628 |
| Compound Name: | 2-(4-{2-methoxy-5-[methyl(2-phenylethyl)sulfamoyl]phenyl}piperazin-1-yl)-2-oxo-1-phenylethyl acetate |
| Molecular Weight: | 565.69 |
| Molecular Formula: | C30 H35 N3 O6 S |
| Salt: | not_available |
| Smiles: | CC(=O)OC(C(N1CCN(CC1)c1cc(ccc1OC)S(N(C)CCc1ccccc1)(=O)=O)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4531 |
| logD: | 4.4531 |
| logSw: | -4.3974 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 80.526 |
| InChI Key: | BCSOHDVEBUYNQP-GDLZYMKVSA-N |