N-[(4-chlorophenyl)methyl]-N-[1-(4-fluorobenzoyl)piperidin-4-yl]-N~2~-(2-methoxyethyl)-N~2~-(propane-1-sulfonyl)glycinamide
Chemical Structure Depiction of
N-[(4-chlorophenyl)methyl]-N-[1-(4-fluorobenzoyl)piperidin-4-yl]-N~2~-(2-methoxyethyl)-N~2~-(propane-1-sulfonyl)glycinamide
N-[(4-chlorophenyl)methyl]-N-[1-(4-fluorobenzoyl)piperidin-4-yl]-N~2~-(2-methoxyethyl)-N~2~-(propane-1-sulfonyl)glycinamide
Compound characteristics
| Compound ID: | V010-4183 |
| Compound Name: | N-[(4-chlorophenyl)methyl]-N-[1-(4-fluorobenzoyl)piperidin-4-yl]-N~2~-(2-methoxyethyl)-N~2~-(propane-1-sulfonyl)glycinamide |
| Molecular Weight: | 568.11 |
| Molecular Formula: | C27 H35 Cl F N3 O5 S |
| Smiles: | CCCS(N(CCOC)CC(N(Cc1ccc(cc1)[Cl])C1CCN(CC1)C(c1ccc(cc1)F)=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2554 |
| logD: | 3.2554 |
| logSw: | -3.7243 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 71.485 |
| InChI Key: | LAQTYAXRYPFLGW-UHFFFAOYSA-N |