1-{[(3,5-dimethoxyphenyl)methyl](2-methoxyethyl)amino}-3-[(furan-2-yl)methoxy]propan-2-ol
Chemical Structure Depiction of
1-{[(3,5-dimethoxyphenyl)methyl](2-methoxyethyl)amino}-3-[(furan-2-yl)methoxy]propan-2-ol
1-{[(3,5-dimethoxyphenyl)methyl](2-methoxyethyl)amino}-3-[(furan-2-yl)methoxy]propan-2-ol
Compound characteristics
| Compound ID: | V010-7797 |
| Compound Name: | 1-{[(3,5-dimethoxyphenyl)methyl](2-methoxyethyl)amino}-3-[(furan-2-yl)methoxy]propan-2-ol |
| Molecular Weight: | 379.45 |
| Molecular Formula: | C20 H29 N O6 |
| Salt: | not_available |
| Smiles: | COCCN(CC(COCc1ccco1)O)Cc1cc(cc(c1)OC)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.3167 |
| logD: | 0.0343 |
| logSw: | -2.3077 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.161 |
| InChI Key: | JIDYHQXKPIGEFP-KRWDZBQOSA-N |