N-(5-{[2-(4-methylphenyl)-2-oxoethyl]sulfanyl}-1,3,4-thiadiazol-2-yl)acetamide
Chemical Structure Depiction of
N-(5-{[2-(4-methylphenyl)-2-oxoethyl]sulfanyl}-1,3,4-thiadiazol-2-yl)acetamide
N-(5-{[2-(4-methylphenyl)-2-oxoethyl]sulfanyl}-1,3,4-thiadiazol-2-yl)acetamide
Compound characteristics
| Compound ID: | V010-8097 |
| Compound Name: | N-(5-{[2-(4-methylphenyl)-2-oxoethyl]sulfanyl}-1,3,4-thiadiazol-2-yl)acetamide |
| Molecular Weight: | 307.39 |
| Molecular Formula: | C13 H13 N3 O2 S2 |
| Salt: | not_available |
| Smiles: | CC(Nc1nnc(SCC(c2ccc(C)cc2)=O)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9249 |
| logD: | 2.9241 |
| logSw: | -3.3781 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.382 |
| InChI Key: | RWEYLOUYMBWDPQ-UHFFFAOYSA-N |