N-{2-[5-(3,4-dimethoxyphenyl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)propanamide
Chemical Structure Depiction of
N-{2-[5-(3,4-dimethoxyphenyl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)propanamide
N-{2-[5-(3,4-dimethoxyphenyl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)propanamide
Compound characteristics
| Compound ID: | V010-8867 |
| Compound Name: | N-{2-[5-(3,4-dimethoxyphenyl)-3-(2-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)propanamide |
| Molecular Weight: | 471.53 |
| Molecular Formula: | C25 H30 F N3 O5 |
| Smiles: | CCC(N(CCOC)CC(N1C(CC(c2ccccc2F)=N1)c1ccc(c(c1)OC)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.0109 |
| logD: | 3.0108 |
| logSw: | -3.3308 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 66.396 |
| InChI Key: | WBHQDIXAKZGNKR-OAQYLSRUSA-N |