N~3~-[2-(4-fluorophenyl)quinazolin-4-yl]-N~3~-[(furan-2-yl)methyl]-N-(2-methylpropyl)-beta-alaninamide
Chemical Structure Depiction of
N~3~-[2-(4-fluorophenyl)quinazolin-4-yl]-N~3~-[(furan-2-yl)methyl]-N-(2-methylpropyl)-beta-alaninamide
N~3~-[2-(4-fluorophenyl)quinazolin-4-yl]-N~3~-[(furan-2-yl)methyl]-N-(2-methylpropyl)-beta-alaninamide
Compound characteristics
| Compound ID: | V010-9444 |
| Compound Name: | N~3~-[2-(4-fluorophenyl)quinazolin-4-yl]-N~3~-[(furan-2-yl)methyl]-N-(2-methylpropyl)-beta-alaninamide |
| Molecular Weight: | 446.52 |
| Molecular Formula: | C26 H27 F N4 O2 |
| Salt: | not_available |
| Smiles: | CC(C)CNC(CCN(Cc1ccco1)c1c2ccccc2nc(c2ccc(cc2)F)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7356 |
| logD: | 5.4544 |
| logSw: | -5.781 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.4 |
| InChI Key: | DUFOOVDACZMZOF-UHFFFAOYSA-N |