ethyl 1-(2-fluorophenyl)-5-[3-(4-methylbenzamido)phenyl]-1H-pyrazole-3-carboxylate
Chemical Structure Depiction of
ethyl 1-(2-fluorophenyl)-5-[3-(4-methylbenzamido)phenyl]-1H-pyrazole-3-carboxylate
ethyl 1-(2-fluorophenyl)-5-[3-(4-methylbenzamido)phenyl]-1H-pyrazole-3-carboxylate
Compound characteristics
| Compound ID: | V010-9491 |
| Compound Name: | ethyl 1-(2-fluorophenyl)-5-[3-(4-methylbenzamido)phenyl]-1H-pyrazole-3-carboxylate |
| Molecular Weight: | 443.48 |
| Molecular Formula: | C26 H22 F N3 O3 |
| Smiles: | CCOC(c1cc(c2cccc(c2)NC(c2ccc(C)cc2)=O)n(c2ccccc2F)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.757 |
| logD: | 5.757 |
| logSw: | -5.5214 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.605 |
| InChI Key: | CMDYENXUDRCHGL-UHFFFAOYSA-N |