4-({2-[4-(2-phenylbutanoyl)piperazin-1-yl]-1-[3-(pyrrolidin-1-yl)phenyl]ethoxy}methyl)benzonitrile
Chemical Structure Depiction of
4-({2-[4-(2-phenylbutanoyl)piperazin-1-yl]-1-[3-(pyrrolidin-1-yl)phenyl]ethoxy}methyl)benzonitrile
4-({2-[4-(2-phenylbutanoyl)piperazin-1-yl]-1-[3-(pyrrolidin-1-yl)phenyl]ethoxy}methyl)benzonitrile
Compound characteristics
| Compound ID: | V010-9878 |
| Compound Name: | 4-({2-[4-(2-phenylbutanoyl)piperazin-1-yl]-1-[3-(pyrrolidin-1-yl)phenyl]ethoxy}methyl)benzonitrile |
| Molecular Weight: | 536.72 |
| Molecular Formula: | C34 H40 N4 O2 |
| Salt: | not_available |
| Smiles: | CCC(C(N1CCN(CC1)CC(c1cccc(c1)N1CCCC1)OCc1ccc(C#N)cc1)=O)c1ccccc1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.378 |
| logD: | 5.3717 |
| logSw: | -5.3864 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.182 |
| InChI Key: | FIJXCDLDFWFFOA-UHFFFAOYSA-N |