2-{[(2,3-difluorophenyl)methyl]sulfanyl}-N,N-diethyl-1-(propan-2-yl)-1H-benzimidazole-5-sulfonamide
Chemical Structure Depiction of
2-{[(2,3-difluorophenyl)methyl]sulfanyl}-N,N-diethyl-1-(propan-2-yl)-1H-benzimidazole-5-sulfonamide
2-{[(2,3-difluorophenyl)methyl]sulfanyl}-N,N-diethyl-1-(propan-2-yl)-1H-benzimidazole-5-sulfonamide
Compound characteristics
| Compound ID: | V011-0000 |
| Compound Name: | 2-{[(2,3-difluorophenyl)methyl]sulfanyl}-N,N-diethyl-1-(propan-2-yl)-1H-benzimidazole-5-sulfonamide |
| Molecular Weight: | 453.57 |
| Molecular Formula: | C21 H25 F2 N3 O2 S2 |
| Salt: | not_available |
| Smiles: | CCN(CC)S(c1ccc2c(c1)nc(n2C(C)C)SCc1cccc(c1F)F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4032 |
| logD: | 5.4029 |
| logSw: | -5.5209 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 42.921 |
| InChI Key: | BWYRBNVJCLJVGM-UHFFFAOYSA-N |