N-{3-[benzyl(methyl)carbamoyl]-4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl}thiophene-2-carboxamide
Chemical Structure Depiction of
N-{3-[benzyl(methyl)carbamoyl]-4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl}thiophene-2-carboxamide
N-{3-[benzyl(methyl)carbamoyl]-4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl}thiophene-2-carboxamide
Compound characteristics
| Compound ID: | V011-0208 |
| Compound Name: | N-{3-[benzyl(methyl)carbamoyl]-4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl}thiophene-2-carboxamide |
| Molecular Weight: | 568.7 |
| Molecular Formula: | C32 H32 N4 O4 S |
| Salt: | not_available |
| Smiles: | CN(Cc1ccccc1)C(c1cc(ccc1N1CCN(CC1)C(c1ccc(cc1)OC)=O)NC(c1cccs1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8778 |
| logD: | 4.8778 |
| logSw: | -4.5162 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.65 |
| InChI Key: | LJIBIPKVTLUCJH-UHFFFAOYSA-N |