ethyl 6-[(3-ethylphenoxy)methyl]-4-(2-fluorophenyl)-1-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
ethyl 6-[(3-ethylphenoxy)methyl]-4-(2-fluorophenyl)-1-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
ethyl 6-[(3-ethylphenoxy)methyl]-4-(2-fluorophenyl)-1-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | V011-0716 |
| Compound Name: | ethyl 6-[(3-ethylphenoxy)methyl]-4-(2-fluorophenyl)-1-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 412.46 |
| Molecular Formula: | C23 H25 F N2 O4 |
| Smiles: | CCc1cccc(c1)OCC1=C(C(c2ccccc2F)NC(N1C)=O)C(=O)OCC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.503 |
| logD: | 4.4976 |
| logSw: | -4.3863 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.018 |
| InChI Key: | BNLFSEMQCIKSGX-NRFANRHFSA-N |