1-[2-(4-chlorophenyl)-2-{[4-(trifluoromethyl)phenyl]methoxy}ethyl]-4-[2-(trifluoromethyl)benzene-1-sulfonyl]piperazine
Chemical Structure Depiction of
1-[2-(4-chlorophenyl)-2-{[4-(trifluoromethyl)phenyl]methoxy}ethyl]-4-[2-(trifluoromethyl)benzene-1-sulfonyl]piperazine
1-[2-(4-chlorophenyl)-2-{[4-(trifluoromethyl)phenyl]methoxy}ethyl]-4-[2-(trifluoromethyl)benzene-1-sulfonyl]piperazine
Compound characteristics
| Compound ID: | V011-0984 |
| Compound Name: | 1-[2-(4-chlorophenyl)-2-{[4-(trifluoromethyl)phenyl]methoxy}ethyl]-4-[2-(trifluoromethyl)benzene-1-sulfonyl]piperazine |
| Molecular Weight: | 607.01 |
| Molecular Formula: | C27 H25 Cl F6 N2 O3 S |
| Salt: | not_available |
| Smiles: | C1CN(CCN1CC(c1ccc(cc1)[Cl])OCc1ccc(cc1)C(F)(F)F)S(c1ccccc1C(F)(F)F)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.3693 |
| logD: | 6.3681 |
| logSw: | -6.7216 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 42.37 |
| InChI Key: | ANYIXYYMIBEZIC-DEOSSOPVSA-N |