4-{[(2,4-dimethylphenyl)sulfanyl]methyl}-2-[(4-methylphenyl)methyl]-1,3-thiazole
Chemical Structure Depiction of
4-{[(2,4-dimethylphenyl)sulfanyl]methyl}-2-[(4-methylphenyl)methyl]-1,3-thiazole
4-{[(2,4-dimethylphenyl)sulfanyl]methyl}-2-[(4-methylphenyl)methyl]-1,3-thiazole
Compound characteristics
| Compound ID: | V011-1283 |
| Compound Name: | 4-{[(2,4-dimethylphenyl)sulfanyl]methyl}-2-[(4-methylphenyl)methyl]-1,3-thiazole |
| Molecular Weight: | 339.52 |
| Molecular Formula: | C20 H21 N S2 |
| Salt: | not_available |
| Smiles: | Cc1ccc(Cc2nc(CSc3ccc(C)cc3C)cs2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.5848 |
| logD: | 6.5848 |
| logSw: | -5.7052 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 10.6913 |
| InChI Key: | QKFIHLPXGJGXFG-UHFFFAOYSA-N |