4-[4-(2-chlorophenyl)-5-{[(4-methoxyphenyl)methyl]sulfanyl}-4H-1,2,4-triazol-3-yl]pyridine
Chemical Structure Depiction of
4-[4-(2-chlorophenyl)-5-{[(4-methoxyphenyl)methyl]sulfanyl}-4H-1,2,4-triazol-3-yl]pyridine
4-[4-(2-chlorophenyl)-5-{[(4-methoxyphenyl)methyl]sulfanyl}-4H-1,2,4-triazol-3-yl]pyridine
Compound characteristics
| Compound ID: | V011-1444 |
| Compound Name: | 4-[4-(2-chlorophenyl)-5-{[(4-methoxyphenyl)methyl]sulfanyl}-4H-1,2,4-triazol-3-yl]pyridine |
| Molecular Weight: | 408.91 |
| Molecular Formula: | C21 H17 Cl N4 O S |
| Salt: | not_available |
| Smiles: | COc1ccc(CSc2nnc(c3ccncc3)n2c2ccccc2[Cl])cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.2362 |
| logD: | 4.2361 |
| logSw: | -4.447 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 41.384 |
| InChI Key: | FKBBKSBMTNGWLW-UHFFFAOYSA-N |