3-(3-fluorophenyl)-6,7,8-trimethoxy-2-{[(3-methylphenyl)methyl]sulfanyl}quinazolin-4(3H)-one
Chemical Structure Depiction of
3-(3-fluorophenyl)-6,7,8-trimethoxy-2-{[(3-methylphenyl)methyl]sulfanyl}quinazolin-4(3H)-one
3-(3-fluorophenyl)-6,7,8-trimethoxy-2-{[(3-methylphenyl)methyl]sulfanyl}quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | V011-1806 |
| Compound Name: | 3-(3-fluorophenyl)-6,7,8-trimethoxy-2-{[(3-methylphenyl)methyl]sulfanyl}quinazolin-4(3H)-one |
| Molecular Weight: | 466.53 |
| Molecular Formula: | C25 H23 F N2 O4 S |
| Smiles: | Cc1cccc(CSC2=Nc3c(cc(c(c3OC)OC)OC)C(N2c2cccc(c2)F)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.379 |
| logD: | 5.3789 |
| logSw: | -5.4383 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 45.972 |
| InChI Key: | RWZCGKLNWWAACH-UHFFFAOYSA-N |