3-{[(3-methoxyphenyl)methyl]sulfanyl}-5-(3-methylphenyl)-4-phenyl-4H-1,2,4-triazole
Chemical Structure Depiction of
3-{[(3-methoxyphenyl)methyl]sulfanyl}-5-(3-methylphenyl)-4-phenyl-4H-1,2,4-triazole
3-{[(3-methoxyphenyl)methyl]sulfanyl}-5-(3-methylphenyl)-4-phenyl-4H-1,2,4-triazole
Compound characteristics
| Compound ID: | V011-2223 |
| Compound Name: | 3-{[(3-methoxyphenyl)methyl]sulfanyl}-5-(3-methylphenyl)-4-phenyl-4H-1,2,4-triazole |
| Molecular Weight: | 387.5 |
| Molecular Formula: | C23 H21 N3 O S |
| Salt: | not_available |
| Smiles: | Cc1cccc(c1)c1nnc(n1c1ccccc1)SCc1cccc(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 5.6927 |
| logD: | 5.6927 |
| logSw: | -5.5986 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.256 |
| InChI Key: | UZJAMJBXOLJYEA-UHFFFAOYSA-N |