N-[2-chloro-5-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)phenyl]-4-fluoro-3-methylbenzamide
Chemical Structure Depiction of
N-[2-chloro-5-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)phenyl]-4-fluoro-3-methylbenzamide
N-[2-chloro-5-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)phenyl]-4-fluoro-3-methylbenzamide
Compound characteristics
| Compound ID: | V011-2533 |
| Compound Name: | N-[2-chloro-5-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)phenyl]-4-fluoro-3-methylbenzamide |
| Molecular Weight: | 384.84 |
| Molecular Formula: | C21 H18 Cl F N2 O2 |
| Smiles: | Cc1cc(ccc1F)C(Nc1cc(ccc1[Cl])c1c2CCCCc2no1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6499 |
| logD: | 5.6469 |
| logSw: | -5.937 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.821 |
| InChI Key: | YVUZZLLBMRXIJN-UHFFFAOYSA-N |