1-(4-{6-(methoxymethyl)-5-[(4-methylphenyl)methyl]-2-phenylpyrimidin-4-yl}piperazin-1-yl)hex-5-en-2-ol
Chemical Structure Depiction of
1-(4-{6-(methoxymethyl)-5-[(4-methylphenyl)methyl]-2-phenylpyrimidin-4-yl}piperazin-1-yl)hex-5-en-2-ol
1-(4-{6-(methoxymethyl)-5-[(4-methylphenyl)methyl]-2-phenylpyrimidin-4-yl}piperazin-1-yl)hex-5-en-2-ol
Compound characteristics
| Compound ID: | V011-3099 |
| Compound Name: | 1-(4-{6-(methoxymethyl)-5-[(4-methylphenyl)methyl]-2-phenylpyrimidin-4-yl}piperazin-1-yl)hex-5-en-2-ol |
| Molecular Weight: | 486.66 |
| Molecular Formula: | C30 H38 N4 O2 |
| Salt: | not_available |
| Smiles: | Cc1ccc(Cc2c(COC)nc(c3ccccc3)nc2N2CCN(CC2)CC(CCC=C)O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.253 |
| logD: | 5.7204 |
| logSw: | -5.678 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.773 |
| InChI Key: | DUYVJGWHVIPOEX-SANMLTNESA-N |