1-(4-{6-ethyl-5-[(2-fluorophenyl)methyl]-2-phenylpyrimidin-4-yl}piperazin-1-yl)hex-5-en-2-ol
Chemical Structure Depiction of
1-(4-{6-ethyl-5-[(2-fluorophenyl)methyl]-2-phenylpyrimidin-4-yl}piperazin-1-yl)hex-5-en-2-ol
1-(4-{6-ethyl-5-[(2-fluorophenyl)methyl]-2-phenylpyrimidin-4-yl}piperazin-1-yl)hex-5-en-2-ol
Compound characteristics
| Compound ID: | V011-3110 |
| Compound Name: | 1-(4-{6-ethyl-5-[(2-fluorophenyl)methyl]-2-phenylpyrimidin-4-yl}piperazin-1-yl)hex-5-en-2-ol |
| Molecular Weight: | 474.62 |
| Molecular Formula: | C29 H35 F N4 O |
| Salt: | not_available |
| Smiles: | CCc1c(Cc2ccccc2F)c(nc(c2ccccc2)n1)N1CCN(CC1)CC(CCC=C)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.8308 |
| logD: | 6.2982 |
| logSw: | -5.9267 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.349 |
| InChI Key: | RIDAXTWIYYYFTI-DEOSSOPVSA-N |