3-(3-chlorophenyl)-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(1-ethyl-1H-indol-3-yl)propan-1-one
Chemical Structure Depiction of
3-(3-chlorophenyl)-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(1-ethyl-1H-indol-3-yl)propan-1-one
3-(3-chlorophenyl)-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(1-ethyl-1H-indol-3-yl)propan-1-one
Compound characteristics
| Compound ID: | V011-3188 |
| Compound Name: | 3-(3-chlorophenyl)-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(1-ethyl-1H-indol-3-yl)propan-1-one |
| Molecular Weight: | 452.98 |
| Molecular Formula: | C26 H29 Cl N2 O3 |
| Smiles: | CCn1cc(C(CC(N2CCC3(CC2)OCCO3)=O)c2cccc(c2)[Cl])c2ccccc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1891 |
| logD: | 4.1891 |
| logSw: | -4.4431 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.253 |
| InChI Key: | KDOMPVVTZAOMTF-JOCHJYFZSA-N |