N~6~-benzyl-2-methyl-4-[4-(trifluoromethyl)phenyl]-2H-pyrazolo[3,4-d]pyrimidine-3,6-diamine
Chemical Structure Depiction of
N~6~-benzyl-2-methyl-4-[4-(trifluoromethyl)phenyl]-2H-pyrazolo[3,4-d]pyrimidine-3,6-diamine
N~6~-benzyl-2-methyl-4-[4-(trifluoromethyl)phenyl]-2H-pyrazolo[3,4-d]pyrimidine-3,6-diamine
Compound characteristics
| Compound ID: | V011-3268 |
| Compound Name: | N~6~-benzyl-2-methyl-4-[4-(trifluoromethyl)phenyl]-2H-pyrazolo[3,4-d]pyrimidine-3,6-diamine |
| Molecular Weight: | 398.39 |
| Molecular Formula: | C20 H17 F3 N6 |
| Salt: | not_available |
| Smiles: | Cn1c(c2c(c3ccc(cc3)C(F)(F)F)nc(NCc3ccccc3)nc2n1)N |
| Stereo: | ACHIRAL |
| logP: | 3.8715 |
| logD: | 3.871 |
| logSw: | -4.3772 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 65.232 |
| InChI Key: | FTYDHIVQUSRAEK-UHFFFAOYSA-N |