1-(5-fluoro-2-methylbenzene-1-sulfonyl)-4-[(4-methylphenyl)(phenyl)methyl]piperazine
Chemical Structure Depiction of
1-(5-fluoro-2-methylbenzene-1-sulfonyl)-4-[(4-methylphenyl)(phenyl)methyl]piperazine
1-(5-fluoro-2-methylbenzene-1-sulfonyl)-4-[(4-methylphenyl)(phenyl)methyl]piperazine
Compound characteristics
| Compound ID: | V011-4200 |
| Compound Name: | 1-(5-fluoro-2-methylbenzene-1-sulfonyl)-4-[(4-methylphenyl)(phenyl)methyl]piperazine |
| Molecular Weight: | 438.56 |
| Molecular Formula: | C25 H27 F N2 O2 S |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1)C(c1ccccc1)N1CCN(CC1)S(c1cc(ccc1C)F)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4499 |
| logD: | 5.4474 |
| logSw: | -5.4739 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 34.511 |
| InChI Key: | QDPCKGYGMMYNKU-VWLOTQADSA-N |