2-(3-methoxyphenyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine
Chemical Structure Depiction of
2-(3-methoxyphenyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine
2-(3-methoxyphenyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine
Compound characteristics
| Compound ID: | V011-4621 |
| Compound Name: | 2-(3-methoxyphenyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine |
| Molecular Weight: | 351.49 |
| Molecular Formula: | C22 H29 N3 O |
| Salt: | not_available |
| Smiles: | CC(C)(C)CC(C)(C)Nc1c(c2cccc(c2)OC)nc2ccccn12 |
| Stereo: | ACHIRAL |
| logP: | 5.6003 |
| logD: | 4.9526 |
| logSw: | -5.5784 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.1074 |
| InChI Key: | OYHLHQXUNOKLAL-UHFFFAOYSA-N |