N-tert-butyl-6-chloro-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-amine
Chemical Structure Depiction of
N-tert-butyl-6-chloro-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-amine
N-tert-butyl-6-chloro-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-amine
Compound characteristics
| Compound ID: | V011-4674 |
| Compound Name: | N-tert-butyl-6-chloro-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-amine |
| Molecular Weight: | 313.83 |
| Molecular Formula: | C18 H20 Cl N3 |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1)c1c(NC(C)(C)C)n2cc(ccc2n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.3838 |
| logD: | 5.2534 |
| logSw: | -6.2406 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 17.9894 |
| InChI Key: | GLCRZWHGEHCSNJ-UHFFFAOYSA-N |