N-{3-[3-(3-fluoro-4-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}-2-methylbenzamide
Chemical Structure Depiction of
N-{3-[3-(3-fluoro-4-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}-2-methylbenzamide
N-{3-[3-(3-fluoro-4-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}-2-methylbenzamide
Compound characteristics
| Compound ID: | V011-8381 |
| Compound Name: | N-{3-[3-(3-fluoro-4-methylphenyl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}-2-methylbenzamide |
| Molecular Weight: | 420.5 |
| Molecular Formula: | C24 H21 F N2 O2 S |
| Smiles: | Cc1ccccc1C(Nc1cccc(c1)C1N(C(CS1)=O)c1ccc(C)c(c1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0746 |
| logD: | 5.0741 |
| logSw: | -4.7504 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.224 |
| InChI Key: | OKEIQBNMFUBYJT-DEOSSOPVSA-N |