7-chloro-3-(3-methylphenyl)-4H-1-benzopyran-4-one
Chemical Structure Depiction of
7-chloro-3-(3-methylphenyl)-4H-1-benzopyran-4-one
7-chloro-3-(3-methylphenyl)-4H-1-benzopyran-4-one
Compound characteristics
| Compound ID: | V011-8556 |
| Compound Name: | 7-chloro-3-(3-methylphenyl)-4H-1-benzopyran-4-one |
| Molecular Weight: | 270.71 |
| Molecular Formula: | C16 H11 Cl O2 |
| Smiles: | Cc1cccc(c1)C1=COc2cc(ccc2C1=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.343 |
| logD: | 4.343 |
| logSw: | -4.6289 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 20.86 |
| InChI Key: | UKOHOYGFGJOBHT-UHFFFAOYSA-N |