N~2~-(benzenesulfonyl)-N-[1-(3-chlorobenzoyl)piperidin-4-yl]-N-[(4-methoxyphenyl)methyl]-N~2~-propylglycinamide
Chemical Structure Depiction of
N~2~-(benzenesulfonyl)-N-[1-(3-chlorobenzoyl)piperidin-4-yl]-N-[(4-methoxyphenyl)methyl]-N~2~-propylglycinamide
N~2~-(benzenesulfonyl)-N-[1-(3-chlorobenzoyl)piperidin-4-yl]-N-[(4-methoxyphenyl)methyl]-N~2~-propylglycinamide
Compound characteristics
| Compound ID: | V011-8576 |
| Compound Name: | N~2~-(benzenesulfonyl)-N-[1-(3-chlorobenzoyl)piperidin-4-yl]-N-[(4-methoxyphenyl)methyl]-N~2~-propylglycinamide |
| Molecular Weight: | 598.16 |
| Molecular Formula: | C31 H36 Cl N3 O5 S |
| Smiles: | CCCN(CC(N(Cc1ccc(cc1)OC)C1CCN(CC1)C(c1cccc(c1)[Cl])=O)=O)S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9048 |
| logD: | 4.9048 |
| logSw: | -5.0129 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 70.521 |
| InChI Key: | LLFCBWAWBNVPMX-UHFFFAOYSA-N |