2-(2-fluorophenyl)-4-[(3-fluorophenyl)methyl]-6-(pyrrolidine-1-carbonyl)-1,2,4-triazine-3,5(2H,4H)-dione
Chemical Structure Depiction of
2-(2-fluorophenyl)-4-[(3-fluorophenyl)methyl]-6-(pyrrolidine-1-carbonyl)-1,2,4-triazine-3,5(2H,4H)-dione
2-(2-fluorophenyl)-4-[(3-fluorophenyl)methyl]-6-(pyrrolidine-1-carbonyl)-1,2,4-triazine-3,5(2H,4H)-dione
Compound characteristics
| Compound ID: | V011-8622 |
| Compound Name: | 2-(2-fluorophenyl)-4-[(3-fluorophenyl)methyl]-6-(pyrrolidine-1-carbonyl)-1,2,4-triazine-3,5(2H,4H)-dione |
| Molecular Weight: | 412.39 |
| Molecular Formula: | C21 H18 F2 N4 O3 |
| Smiles: | C1CCN(C1)C(C1C(N(Cc2cccc(c2)F)C(N(c2ccccc2F)N=1)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.079 |
| logD: | 3.079 |
| logSw: | -3.3468 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 58.958 |
| InChI Key: | QVFXIUNKMACLOT-UHFFFAOYSA-N |