N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-[4-(3-methylbenzamido)piperidin-1-yl]benzamide
Chemical Structure Depiction of
N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-[4-(3-methylbenzamido)piperidin-1-yl]benzamide
N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-[4-(3-methylbenzamido)piperidin-1-yl]benzamide
Compound characteristics
| Compound ID: | V012-0392 |
| Compound Name: | N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-[4-(3-methylbenzamido)piperidin-1-yl]benzamide |
| Molecular Weight: | 471.56 |
| Molecular Formula: | C28 H29 N3 O4 |
| Salt: | not_available |
| Smiles: | Cc1cccc(c1)C(NC1CCN(CC1)c1ccccc1C(NCc1ccc2c(c1)OCO2)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5631 |
| logD: | 4.5631 |
| logSw: | -4.3544 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.865 |
| InChI Key: | HTXCRMQNIBMDIN-UHFFFAOYSA-N |