N-[5-amino-1-benzyl-3-(4-chlorophenyl)-1H-pyrazol-4-yl]-N'-[(3-methylphenyl)methyl]urea
Chemical Structure Depiction of
N-[5-amino-1-benzyl-3-(4-chlorophenyl)-1H-pyrazol-4-yl]-N'-[(3-methylphenyl)methyl]urea
N-[5-amino-1-benzyl-3-(4-chlorophenyl)-1H-pyrazol-4-yl]-N'-[(3-methylphenyl)methyl]urea
Compound characteristics
| Compound ID: | V012-0407 |
| Compound Name: | N-[5-amino-1-benzyl-3-(4-chlorophenyl)-1H-pyrazol-4-yl]-N'-[(3-methylphenyl)methyl]urea |
| Molecular Weight: | 445.95 |
| Molecular Formula: | C25 H24 Cl N5 O |
| Salt: | not_available |
| Smiles: | Cc1cccc(CNC(Nc2c(c3ccc(cc3)[Cl])nn(Cc3ccccc3)c2N)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.5197 |
| logD: | 4.5197 |
| logSw: | -4.7569 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 65.923 |
| InChI Key: | HAFGUSUGNRBKDB-UHFFFAOYSA-N |