4-({[2-(dimethylamino)ethyl](phenylacetyl)amino}methyl)phenyl 4-fluorobenzene-1-sulfonate
					Chemical Structure Depiction of
4-({[2-(dimethylamino)ethyl](phenylacetyl)amino}methyl)phenyl 4-fluorobenzene-1-sulfonate
			4-({[2-(dimethylamino)ethyl](phenylacetyl)amino}methyl)phenyl 4-fluorobenzene-1-sulfonate
Compound characteristics
| Compound ID: | V012-0878 | 
| Compound Name: | 4-({[2-(dimethylamino)ethyl](phenylacetyl)amino}methyl)phenyl 4-fluorobenzene-1-sulfonate | 
| Molecular Weight: | 470.56 | 
| Molecular Formula: | C25 H27 F N2 O4 S | 
| Smiles: | CN(C)CCN(Cc1ccc(cc1)OS(c1ccc(cc1)F)(=O)=O)C(Cc1ccccc1)=O | 
| Stereo: | ACHIRAL | 
| logP: | 3.9246 | 
| logD: | 2.9741 | 
| logSw: | -3.8886 | 
| Hydrogen bond acceptors count: | 8 | 
| Polar surface area: | 55.528 | 
| InChI Key: | GKPOVDWNUDDVOX-UHFFFAOYSA-N | 
 
				 
				