2-methyl-N-[6-(2-methylphenoxy)pyridin-3-yl]benzene-1-sulfonamide
Chemical Structure Depiction of
2-methyl-N-[6-(2-methylphenoxy)pyridin-3-yl]benzene-1-sulfonamide
2-methyl-N-[6-(2-methylphenoxy)pyridin-3-yl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | V012-1245 |
| Compound Name: | 2-methyl-N-[6-(2-methylphenoxy)pyridin-3-yl]benzene-1-sulfonamide |
| Molecular Weight: | 354.43 |
| Molecular Formula: | C19 H18 N2 O3 S |
| Salt: | not_available |
| Smiles: | Cc1ccccc1Oc1ccc(cn1)NS(c1ccccc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1713 |
| logD: | 3.9391 |
| logSw: | -4.342 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.76 |
| InChI Key: | YBBDWKZGUYYDOG-UHFFFAOYSA-N |