N-[6-(2,5-dimethylphenoxy)pyridin-3-yl]-3-methoxybenzene-1-sulfonamide
Chemical Structure Depiction of
N-[6-(2,5-dimethylphenoxy)pyridin-3-yl]-3-methoxybenzene-1-sulfonamide
N-[6-(2,5-dimethylphenoxy)pyridin-3-yl]-3-methoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | V012-1256 |
| Compound Name: | N-[6-(2,5-dimethylphenoxy)pyridin-3-yl]-3-methoxybenzene-1-sulfonamide |
| Molecular Weight: | 384.45 |
| Molecular Formula: | C20 H20 N2 O4 S |
| Salt: | not_available |
| Smiles: | Cc1ccc(C)c(c1)Oc1ccc(cn1)NS(c1cccc(c1)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5407 |
| logD: | 4.5217 |
| logSw: | -4.351 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.304 |
| InChI Key: | HJEVJVUMUYQZAM-UHFFFAOYSA-N |