N-[6-(2,6-dimethylphenoxy)pyridin-3-yl]-4-methylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-[6-(2,6-dimethylphenoxy)pyridin-3-yl]-4-methylbenzene-1-sulfonamide
N-[6-(2,6-dimethylphenoxy)pyridin-3-yl]-4-methylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | V012-1280 |
| Compound Name: | N-[6-(2,6-dimethylphenoxy)pyridin-3-yl]-4-methylbenzene-1-sulfonamide |
| Molecular Weight: | 368.45 |
| Molecular Formula: | C20 H20 N2 O3 S |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1)S(Nc1ccc(nc1)Oc1c(C)cccc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.142 |
| logD: | 5.0849 |
| logSw: | -4.9913 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.847 |
| InChI Key: | WXWFCSGDQVOXGN-UHFFFAOYSA-N |